Phenyl 2,3,4,6-tetra-O-benzyl-b-D-thioglucopyranoside
Phenyl 2,3,4,6-tetra-O-benzyl-b-D-thioglucopyranoside is an extensively employed chemical compound within the biomedical industry, showcasing its utility as a substrate. It adeptly facilitates the synthesis of intricate glycosides, offering immense potential in the research of a multitude of ailments, including cancer, diabetes and infectious diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 38184-10-0 |
| Pricing | Inquire |
| Cas | 38184-10-0 |
| Molecular Weight | 632.83 |
| Molecular Formula | C40H41O5S |
| Canonical SMILES | C1=CC=C(C=C1)COCC2C(C(C(C(O2)SC3=CC=CC=C3)OCC4=CC=CC=C4)OCC5=CC=CC=C5)OCC6=CC=CC=C6 |