8-Bromo-2',3',5'-tri-O-acetyladenosine
8-Bromo-2',3',5'-tri-O-acetyladenosine is a potent and selective inhibitor to study the role of adenosine receptors in various diseases, such as cancer, cardiovascular disorders and inflammatory conditions. It has the ability to modulate adenosine signaling pathways.
| Supplier | BOC Sciences |
|---|---|
| Product # | 31281-86-4 |
| Pricing | Inquire |
| Cas | 31281-86-4 |
| Molecular Weight | 472.25 |
| Molecular Formula | C16H18BrN5O7 |
| Canonical SMILES | CC(=O)OCC1C(C(C(O1)N2C3=C(C(=NC=N3)N)N=C2Br)OC(=O)C)OC(=O)C |