Lorglumide sodium
Lorglumide sodium is a potent and selective cholecystokinin A (CCKA) antagonist. CCKA is a peptide hormone of the gastrointestinal system that promotes fat and protein digestion. Lorglumide is used as a drug suppressing gastrointestinal motility and reducing gastric secretions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1021868-76-7 |
| Pricing | Inquire |
| Cas | 1021868-76-7 |
| Molecular Weight | 481.4 |
| Molecular Formula | C22H31Cl2N2O4·Na |
| Canonical SMILES | CCCCCN(CCCCC)C(=O)C(CCC(=O)[O-])NC(=O)C1=CC(=C(C=C1)Cl)Cl.[Na+] |