Tributyl prop-1-ene-1,2,3-tricarboxylate (mixture of E and Z)
Tributyl prop-1-ene-1,2,3-tricarboxylate (mixture of E and Z) is a multifaceted compound, actively employed for synthesizing pharmaceuticals and agrochemicals. The inherent plasticizing properties of this compound have sparked interest in the polymer industry. Furthermore, several studies have been conducted on its additional applications as well.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2699-129839 |
| Pricing | Inquire |
| Cas | 7568-58-3 |
| Molecular Weight | 342.43 |
| Molecular Formula | C18H30O6 |
| Canonical SMILES | CCCCOC(=O)CC(=CC(=O)OCCCC)C(=O)OCCCC |