6,7-diketolithocholic acid
6,7-diketolithocholic acid, a derivative of lithocholic acid, is a promising compound in the biomedical field due to its therapeutic implications for liver ailments and gallstone pathogenesis. Its capacity to regulate bile acid metabolism and impact cholesterol profiles has garnered significant attention from researchers.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1643669-23-1 |
| Pricing | Inquire |
| Cas | 1643669-23-1 |
| Molecular Weight | 404.55 |
| Molecular Formula | C24H36O5 |
| Canonical SMILES | CC(CCC(=O)O)C1CCC2C1(CCC3C2C(=O)C(=O)C4C3(CCC(C4)O)C)C |