2'-Chloro-N6-(4-methoxy)benzyladenosine
2'-Chloro-N6-(4-methoxy)benzyladenosine, a compound with diverse pharmacological effects, is utilized in biomedicine as an effective inhibitor of RNA methyltransferase and adenosine kinase, pivotal enzymes associated with a multitude of debilitating diseases including cancer, neurological disorders, and viral infections. Additionally, this chemical species demonstrates strong anti-inflammatory properties, making it a promising therapeutic target for treating a variety of inflammation-related maladies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 722504-77-0 |
| Pricing | Inquire |
| Cas | 722504-77-0 |
| Molecular Weight | 421.83 |
| Molecular Formula | C18H20ClN5O5 |
| Canonical SMILES | COC1=CC=C(C=C1)CNC2=C3C(=NC(=N2)Cl)N(C=N3)C4C(C(C(O4)CO)O)O |