Blood Group B type I tetrasaccharide
Blood Group B type I tetrasaccharide is a key component used in the biomedical industry for blood typing purposes. It specifically targets individuals with blood type B and aids in the identification and classification of their blood.
| Supplier | BOC Sciences |
|---|---|
| Product # | 67673-41-0 |
| Pricing | Inquire |
| Cas | 67673-41-0 |
| Molecular Weight | 691.63 |
| Molecular Formula | C26H45NO20 |
| Canonical SMILES | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3C(C(OC(C3O)CO)O)NC(=O)C)CO)O)OC4C(C(C(C(O4)CO)O)O)O)O)O)O |