1,6,2',6'-O-Tetraacetyl-3-O-trans-p-coumaroylsucrose
1,6,2',6'-O-Tetraacetyl-3-O-trans-p-coumaroylsucrose is a natural compound used for studying various diseases. It exhibits potential pharmacological activities due to its chemical properties. It can be utilized in the development of drugs targeting specific receptors or enzymes involved in metabolic pathways.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP4401 |
| Pricing | Inquire |
| Cas | 138195-49-0 |
| Molecular Weight | 656.59 |
| Molecular Formula | C29H36O17 |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)OC2(C(C(C(O2)COC(=O)C)O)OC(=O)C=CC3=CC=C(C=C3)O)COC(=O)C)OC(=O)C)O)O |