4-Methylumbelliferyl 2-O-(a-L-fucopyranosyl)-b-D-galactopyranoside
4-Methylumbelliferyl 2-O-(a-L-fucopyranosyl)-b-D-galactopyranoside, a fundamental element in the realm of biomedical research, deftly unveils its significance. With its illuminating properties, this compound serves as an invaluable fluorescent substrate, fostering the detection of α-L-fucosidase.
| Supplier | BOC Sciences |
|---|---|
| Product # | 225217-42-5 |
| Pricing | Inquire |
| Cas | 225217-42-5 |
| Molecular Weight | 484.45 |
| Molecular Formula | C22H28O12 |
| Canonical SMILES | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3=CC4=C(C=C3)C(=CC(=O)O4)C)CO)O)O)O)O)O |