3'-Azido-3'-deoxy-5'-O-methylthymidine
3'-Azido-3'-deoxy-5'-O-methylthymidine is an intricate nucleotide analog, used in the research of antiviral therapeutics targeting DNA viruses, including hepatitis B virus (HBV) and human immunodeficiency virus (HIV). By operating as a chain terminator during viral DNA research and development, this compound effectively stifles replication, culminating in a considerable reduction of viral load.
| Supplier | BOC Sciences |
|---|---|
| Product # | 121456-54-0 |
| Pricing | Inquire |
| Cas | 121456-54-0 |
| Molecular Weight | 281.27 |
| Molecular Formula | C11H15N5O4 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2CC(C(O2)COC)N=[N+]=[N-] |