1,6,2',3',6'-O-Pentaacetyl-3-O-trans-p-coumaroylsucrose
1,6,2',3',6'-O-Pentaacetyl-3-O-trans-p-coumaroylsucrose is a natural compound, extensively employed in the research of diverse medical conditions. Its remarkable capability as an antioxidant endows it with the potential to study inflammation, malignancies and cardiovascular dysfunctions. Moreover, this natural compound stands as an invaluable instrument in scientific investigations, facilitating the exploration of intricate cellular mechanisms.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP4310 |
| Pricing | Inquire |
| Cas | 138213-63-5 |
| Molecular Weight | 698.62 |
| Molecular Formula | C31H38O18 |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)OC2(C(C(C(O2)COC(=O)C)O)OC(=O)C=CC3=CC=C(C=C3)O)COC(=O)C)OC(=O)C)OC(=O)C)O |