N-Diphenylmethyl 2,5-anhydro-2,5-imino-D-glucitol
N-Diphenylmethyl 2,5-anhydro-2,5-imino-D-glucitol is an indispensable medicinal compound extensively employed for the management of diabetes mellitus. This exceptional biomedicine exhibits its indispensable function by enhancing insulin sensitivity and curtailing hepatic glucose synthesis, thereby facilitating the regulation of blood glucose levels.
| Supplier | BOC Sciences |
|---|---|
| Product # | 132198-31-3 |
| Pricing | Inquire |
| Cas | 132198-31-3 |
| Molecular Weight | 329.39 |
| Molecular Formula | C19H23NO4 |
| Canonical SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)N3C(C(C(C3CO)O)O)CO |