7-Deaza-2',3'-dideoxy-7-iodoadenosine
7-Deaza-2',3'-dideoxy-7-iodoadenosine is an exceedingly potent antiviral compound, extensively employed to study specific viral afflictions, predominantly triggered by RNA viruses. By selectively zeroing in on the viral polymerase and curtailing the compoundion of viral RNA, this pharmaceutical compound obstructs viral replication flawlessly.
| Supplier | BOC Sciences |
|---|---|
| Product # | 114748-70-8 |
| Pricing | Inquire |
| Cas | 114748-70-8 |
| Molecular Weight | 360.15 |
| Molecular Formula | C11H13IN4O2 |
| Canonical SMILES | C1CC(OC1CO)N2C=C(C3=C(N=CN=C32)N)I |