5'-O-(2'-Deoxy-3'-adenylyl)thymidine
5'-O-(2'-Deoxy-3'-adenylyl)thymidine, a potent retroviral reverse transcriptase inhibitor, is a nucleoside analog that presents antiviral action against HIV-1 and other retroviruses, and cytotoxic effects towards cancer cell lines, prompting its research as an anticancer agent with promising potential.
| Supplier | BOC Sciences |
|---|---|
| Product # | 23339-47-1 |
| Pricing | Inquire |
| Cas | 23339-47-1 |
| Molecular Weight | 555.40 |
| Molecular Formula | C20H26N7O10P |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2CC(C(O2)COP(=O)(O)OC3CC(OC3CO)N4C=NC5=C(N=CN=C54)N)O |