1-Azido-1-deoxy-β-D-glucopyranoside tetraacetate
1-Azido-1-deoxy-β-D-glucopyranoside tetraacetate (CAS# 13992-25-1) is an intermediate used for the synthesis of Protein Tyrosine Phosphatase 1B inhibito1. It is used for the preparation of variously coupled conjugates of D-glucose via click chemistry for inhibition of glycogen phosphorylase.
| Supplier | BOC Sciences |
|---|---|
| Product # | 13992-25-1 |
| Pricing | Inquire |
| Cas | 13992-25-1 |
| Molecular Weight | 373.32 |
| Molecular Formula | C14H19N3O9 |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)N=[N+]=[N-])OC(=O)C)OC(=O)C)OC(=O)C |