Finasteride Impurity A
The reduced product of Finasteride. Finasteride is a 4-azasteroid analog of testosterone that competitively blocks type II 5α-reductase activity with 100-fold greater affinity than for the type I enzyme.
| Supplier | BOC Sciences |
|---|---|
| Product # | 98319-24-5 |
| Pricing | Inquire |
| Cas | 98319-24-5 |
| Molecular Weight | 374.57 |
| Molecular Formula | C23H38N2O2 |
| Canonical SMILES | CC12CCC3C(C1CCC2C(=O)NC(C)(C)C)CCC4C3(CCC(=O)N4)C |