9-(2-O-Acetyl-5-O-(p-toluoyl)-3-deoxy-3-fluoro-beta-D-ribofuranosyl)-2-amino-6-chloro-9H-purine
9-(2-O-Acetyl-5-O-(p-toluoyl)-3-deoxy-3-fluoro-beta-D-ribofuranosyl)-2-amino-6-chloro-9H-purine is a robust antiviral compound, exhibiting inhibitory efficacy in research of a wide array of viral infections, notably hepatitis B and C. By selectively antagonizing pivotal enzymes implicated in viral nucleotide research and development, this compound powerfully inhibits viral DNA replication.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1612192-25-2 |
| Pricing | Inquire |
| Cas | 1612192-25-2 |
| Molecular Weight | 463.85 |
| Molecular Formula | C20H19ClFN5O5 |
| Canonical SMILES | CC1=CC=C(C=C1)C(=O)OCC2C(C(C(O2)N3C=NC4=C3N=C(N=C4Cl)N)OC(=O)C)F |