Mellitic acid
Mellitic acid (CAS# 517-60-2) is part of a group of benzenepolycarboxylic acids that have potential anti-hemorrhagic properties. Mellitic acid is also used as a motif to investigate possible radial self-assembly using complementary aromatic bases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 517-60-2 |
| Pricing | Inquire |
| Cas | 517-60-2 |
| Molecular Weight | 342.17 |
| Molecular Formula | C12H6O12 |
| Canonical SMILES | C1(=C(C(=C(C(=C1C(=O)O)C(=O)O)C(=O)O)C(=O)O)C(=O)O)C(=O)O |