G-Protein antagonist peptide
G-Protein antagonist peptide is a competitive and reversible inhibitor of M2 muscarinic cholinergic receptors. G-Protein antagonist peptide inhibits M2 muscarinic receptor activation of Gi or Go and suppresses Gs activation by β-adrenoceptors.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-010305 |
| Pricing | Inquire |
| Cas | 143675-79-0 |
| Molecular Weight | 1093.27 |
| Molecular Formula | C57H64N12O9S |
| Canonical SMILES | CSCCC(C(=O)N)NC(=O)C(CC1=CNC2=CC=CC=C21)NC(=O)C(CC3=CNC4=CC=CC=C43)NC(=O)C(CC5=CC=CC=C5)NC(=O)C(CC6=CNC7=CC=CC=C76)NC(=O)C(CCC(=O)N)NC(=O)C8CCC(=O)N8 |