6-O-Benzyl-D-glucose
6-O-Benzyl-D-glucose, a remarkable compound, finds paramount application in the biomedical field due to its prodigious potential in the advancement of antiviral pharmaceuticals. Its efficacy in thwarting viral replication and combating various viral infections, such as influenza, has been particularly auspicious. Extensive research has underscored its exquisite capability to selectively target viral enzymes, rendering it an auspicious contender for forthcoming antiviral therapies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 22170-16-7 |
| Pricing | Inquire |
| Cas | 22170-16-7 |
| Molecular Weight | 270.28 |
| Molecular Formula | C13H18O6 |
| Canonical SMILES | C1=CC=C(C=C1)COCC(C(C(C(C=O)O)O)O)O |