2'-O-tert-Butyldimethylsilyl-N4-(tert-butylphenoxyacetyl)-5'-O-DMT-cytidine 3'-CE phosphoramidite
2'-O-tert-Butyldimethylsilyl-N4-(tert-butylphenoxyacetyl)-5'-O-DMT-cytidine 3'-CE phosphoramidite, an exceptionally intricate and advanced compound, occupies a paramount position within the realm of biomedicine. Its utility primarily lies in the realm of nucleic acid synthesis, dedicated to unraveling and combating a myriad of ailments.
Supplier | BOC Sciences |
---|---|
Product # | 149989-66-2 |
Pricing | Inquire |
Cas | 149989-66-2 |
Molecular Weight | 1050.30 |
Molecular Formula | C57H76N5O10PSi |
Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1C(OC(C1O[Si](C)(C)C(C)(C)C)N2C=CC(=NC2=O)NC(=O)COC3=CC=C(C=C3)C(C)(C)C)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC |