Succinimidyl 7-methoxycoumarin-3-carboxylate
Succinimidyl 7-methoxycoumarin-3-carboxylate is a vital reagent widely used in biomedical research. It is commonly employed for labeling and imaging biomolecules like proteins, peptides, and antibodies, aiding in various applications such as fluorescence resonance energy transfer (FRET) and fluorescence microscopy. Its excellent stability and fluorescence properties enable precise characterization of drug-target interactions and diseases at the molecular level.
| Supplier | BOC Sciences |
|---|---|
| Product # | 150321-92-9 |
| Pricing | Inquire |
| Cas | 150321-92-9 |
| Molecular Weight | 317.25 |
| Molecular Formula | C15H11NO7 |
| Canonical SMILES | COC1=CC2=C(C=C1)C=C(C(=O)O2)C(=O)ON3C(=O)CCC3=O |