5'(R)-C-Methyl-2-thiouridine
5'(R)-C-Methyl-2-thiouridine is an exceptionally potent and impactful compound, holding remarkable potential in studying an array of notorious RNA viruses including dengue, yellow fever, and hepatitis C. The mechanism of its action lies in its exquisite ability to impede viral RNA synthesis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2305416-01-5 |
| Pricing | Inquire |
| Cas | 2305416-01-5 |
| Molecular Weight | 274.29 |
| Molecular Formula | C10H14N2O5S |
| Canonical SMILES | CC(C1C(C(C(O1)N2C=CC(=O)NC2=S)O)O)O |