(S)-4-((tert-Butoxycarbonyl)amino)-3-(3-chlorophenyl)butanoic acid
(S)-4-((tert-Butoxycarbonyl)amino)-3-(3-chlorophenyl)butanoic acid is notable in chemical and pharmaceutical research for its potential applications in peptide synthesis and as a molecular scaffold in drug design, leveraging its specific functional groups for controlled chemical reactions and potential biological activities.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-016485 |
| Pricing | Inquire |
| Cas | 2411197-88-9 |
| Molecular Weight | 313.78 |
| Molecular Formula | C15H20ClNO4 |
| Canonical SMILES | CC(C)(C)OC(=O)NCC(CC(=O)O)C1=CC(=CC=C1)Cl |