8-Abietenic acid
8-Abietenic acid, a secondary metabolite of mucorinic acid, is isolated from a solid culture of the fungus Mucor spp. isolated on insect Acalymma bivittula. It has antibacterial and insecticidal activities.
| Supplier | BOC Sciences |
|---|---|
| Product # | 19402-28-9 |
| Pricing | Inquire |
| Cas | 19402-28-9 |
| Molecular Weight | 304.47 |
| Molecular Formula | C20H32O2 |
| Canonical SMILES | CC(C)C1CCC2=C(C1)CCC3C2(CCCC3(C)C(=O)O)C |