2,5-Diamino-1,4-benzenedithiol dihydrochloride
2,5-Diamino-1,4-benzenedithiol dihydrochloride is a molecular entity applied in the advanced interdisciplinary field of oncological investigations. It demonstrates promise in the process of bioactive compound creation, adept at ushering in programmed cellular destruction, commonly referred to as apoptosis, in cells that bear the telltale signs of malignant transformation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 75464-52-7 |
| Pricing | Inquire |
| Cas | 75464-52-7 |
| Molecular Weight | 245.19 |
| Molecular Formula | C6H8N2S2.2(HCl) |
| Canonical SMILES | C1=C(C(=CC(=C1S)N)S)N.Cl.Cl |