2-Ethoxy-1-[[2'-[(hydroxyamino)iminomethyl][1,1'-biphenyl]-4-yl]methyl]-1H-benzimidazole-7-carboxylic Acid Methyl Ester-[d5]
2-Ethoxy-1-[[2'-[(hydroxyamino)iminomethyl][1,1'-biphenyl]-4-yl]methyl]-1H-benzimidazole-7-carboxylic Acid Methyl Ester-[d5] is the labelled analogue of 2-Ethoxy-1-[[2'-[(hydroxyamino)iminomethyl][1,1'-biphenyl]-4-yl]methyl]-1H-benzimidazole-7-carboxylic Acid Methyl Ester, which is a derivative of Azilsartan and an intermediate in the synthesis of angiotensin II receptor antagonist.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-006423 |
| Pricing | Inquire |
| Cas | 1795133-18-4 |
| Molecular Weight | 449.51 |
| Molecular Formula | C25H19D5N4O4 |
| Canonical SMILES | CCOC1=NC2=CC=CC(=C2N1CC3=CC=C(C=C3)C4=CC=CC=C4C(=NO)N)C(=O)OC |