4-Amino-5-(2-deoxy-b-D-ribofuranosyl)-1-methyl-2(1H)-pyrimidinone
4-Amino-5-(2-deoxy-b-D-ribofuranosyl)-1-methyl-2(1H)-pyrimidinone, a formidable antiviral agent, has gained prominence in the biomedical industry for its profound efficacy in combatting herpes simplex viruses, varicella-zoster virus, Epstein-Barr virus, and cytomegalovirus-induced viral infections. By skillfully thwarting viral DNA polymerase and stalling viral replication, this potent drug remarkably alleviates the gravity and duration of these afflictions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1166395-05-6 |
| Pricing | Inquire |
| Cas | 1166395-05-6 |
| Molecular Weight | 241.24 |
| Molecular Formula | C10H15N3O4 |
| Canonical SMILES | CN1C=C(C(=NC1=O)N)C2CC(C(O2)CO)O |