APC-100
APC-100 is an orally available, vitamin E derivative and androgen receptor (AR) antagonist with potential anti-oxidant, chemopreventative and antineoplastic activity. APC-100 binds to ARs in target tissues thereby inhibiting androgen-induced receptor activation and facilitating the formation of inactive complexes that cannot be translocated to the nucleus. APC-100 may ultimately lead to an inhibition of growth in both AR-dependent and AR-independent prostate tumor cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 950-99-2 |
| Pricing | Inquire |
| Cas | 950-99-2 |
| Molecular Weight | 220.312 |
| Molecular Formula | C14H20O2 |
| Canonical SMILES | CC1=C(C(=C2CCC(OC2=C1C)(C)C)C)O |