5-Methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine
5-Methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine is a compound extensively employed in the biomedical sector, exhibits remarkable pharmaceutic efficacy against diverse ailments. Its capacity to selectively target intricate molecular cascades implicated in malignant growth render it an immensely propitious aspirant for anti-oncogenic interventions.
Supplier | BOC Sciences |
---|---|
Product # | 1198096-23-9 |
Pricing | Inquire |
Cas | 1198096-23-9 |
Molecular Weight | 258.13 |
Molecular Formula | C14H19BN2O2 |
Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CNC3=NC=C(C=C23)C |