Methyl salicylate b-D-O-glucuronide methyl ester
Methyl salicylate b-D-O-glucuronide methyl ester, a multifaceted biomedical compound, exhibits remarkable therapeutic potential in mitigating pain and inflammation. This biologically active derivative, originated from methyl salicylate, exerts pronounced analgesic effects while imparting indispensable insights into drug metabolism investigations as a discernible marker. Within the realm of pharmaceutical research and drug development, the utilization of this compound facilitates a comprehensive comprehension of methyl salicylate's pharmacokinetics and unravels its tremendous potential in efficacious pain management.
| Supplier | BOC Sciences |
|---|---|
| Product # | 226932-59-8 |
| Pricing | Inquire |
| Cas | 226932-59-8 |
| Molecular Weight | 342.30 |
| Molecular Formula | C15H18O9 |
| Canonical SMILES | COC(=O)C1C(C(C(C(O1)OC2=CC=CC=C2C(=O)OC)O)O)O |