1,2,3-Trichloro-4-nitrobenzene
1,2,3-Trichloro-4-nitrobenzene (CAS# 17700-09-3) is a useful synthetic intermediate that is mainly used as the starting material in the synthesis of third generation quinolone antibacterial drugs, such as Lomefloxacin (L469415, HCl) and Ofloxacin (O245750). 2,3,4-Trichloronitrobenzene is also used as the starting material in the synthesis of Aclonifen (A190200); a compound used as a pesticide and herbicide.
| Supplier | BOC Sciences |
|---|---|
| Product # | 17700-09-3 |
| Pricing | Inquire |
| Cas | 17700-09-3 |
| Molecular Weight | 226.44 |
| Molecular Formula | C6H2Cl3NO2 |
| Canonical SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])Cl)Cl)Cl |