S-Metolachlor Metabolite CGA 50720
S-Metolachlor Metabolite CGA 50720 is a metabolite of S-Metolachlor, a herbicide used for weed control. CGA 50720 displays strong inhibitory activity against various liver and colon cancer cell lines.
| Supplier | BOC Sciences |
|---|---|
| Product # | 152019-74-4 |
| Pricing | Inquire |
| Cas | 152019-74-4 |
| Molecular Weight | 207.23 |
| Molecular Formula | C11H13NO3 |
| Canonical SMILES | CCC1=CC=CC(=C1NC(=O)C(=O)O)C |