5'-O-DMT-2'-O-TBDMS-N6-Benzoyl-L-Adenosine 3'-CE phosphoramidite
5'-O-DMT-2'-O-TBDMS-N6-Benzoyl-L-Adenosine 3'-CE phosphoramidite is a crucial reagent used in the synthesis of oligonucleotides for biomedical research. It enables the efficient introduction of N6-benzoyl-L-Adenosine residues into the oligonucleotide chain, thus allowing the study of adenosine-modified nucleic acids. This product finds applications in drug discovery, gene therapy, and understanding diseases related to adenosine signaling pathways.
Supplier | BOC Sciences |
---|---|
Product # | B1370-291981 |
Pricing | Inquire |
Cas | 1803193-36-3 |
Molecular Weight | 988.21 |
Molecular Formula | C53H66N7O8PSi |
Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1C(OC(C1O[Si](C)(C)C(C)(C)C)N2C=NC3=C(N=CN=C32)NC(=O)C4=CC=CC=C4)COC(C5=CC=CC=C5)(C6=CC=C(C=C6)OC)C7=CC=C(C=C7)OC |