Mycophenolic acid b-D-glucuronide
Mycophenolic acid b-D-glucuronide is a vital tool in the biomedical industry commonly used as an immunosuppressive compound to study transplant rejection after kidney, heart, or liver transplantation. This product effectively inhibits T-cell and B-cell proliferation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 31528-44-6 |
| Pricing | Inquire |
| Cas | 31528-44-6 |
| Molecular Weight | 496.46 |
| Molecular Formula | C23H28O12 |
| Canonical SMILES | CC1=C2COC(=O)C2=C(C(=C1OC)CC=C(C)CCC(=O)O)OC3C(C(C(C(O3)C(=O)O)O)O)O |