MZ 1
MZ 1, a hybrid compound that drives the selective proteasomal degradation of bromodomain-containing protein 4 (BRD4), retains high affinity for BRD2, BRD3 and BRD4 bromodomains (Kd = 13-60 nM) but induces preferential degradation of BRD4 over BRD2 and BRD3 (DC50 values for degradation of BRD4 are 8 and 23 nM in H661 and H838 cells, respectively).
| Supplier | BOC Sciences |
|---|---|
| Product # | B2693-170210 |
| Pricing | 10 mg/unit USD $199 |
| Cas | 1797406-69-9 |
| Molecular Weight | 1002.64 |
| Molecular Formula | C49H60ClN9O8S2 |
| Canonical SMILES | CC1=C(SC2=C1C(=NC(C3=NN=C(N32)C)CC(=O)NCCOCCOCCOCC(=O)NC(C(=O)N4CC(CC4C(=O)NCC5=CC=C(C=C5)C6=C(N=CS6)C)O)C(C)(C)C)C7=CC=C(C=C7)Cl)C |