Torreyanic acid
Torreyanic acid is a dimer quinone obtained from the endophytic bacterium Pestalotiopsis microspora. Torreyanic acid is cytotoxic to tumor cells and is 5-10 times more effective in cell lines sensitive to protein kinase C agonists.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-05002 |
| Pricing | Inquire |
| Cas | 176260-42-7 |
| Molecular Weight | 692.75 |
| Molecular Formula | C38H44O12 |
| Canonical SMILES | CCCCCC1C2C3C(OC=C4C3(C(O1)C5=C2C(=O)C6(C(C5=O)O6)CC=C(C)C(=O)O)C(=O)C7(C(C4=O)O7)CC=C(C)C(=O)O)CCCCC |