5'(R)-C-Methyluridine
5'(R)-C-Methyluridine is an essential biomedical compound, serving as an indispensable weapon in research of viral infections and cancer. Its remarkable antiviral properties enable the effective suppression of RNA-based viruses such as hepatitis and HIV. Moreover, by actively participating in the intricate process of RNA and DNA research and development, this compound greatly aids in unraveling the complexities of genetic diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 72159-54-7 |
| Pricing | Inquire |
| Cas | 72159-54-7 |
| Molecular Weight | 258.23 |
| Molecular Formula | C10H14N2O6 |
| Canonical SMILES | CC(C1C(C(C(O1)N2C=CC(=O)NC2=O)O)O)O |