Alpha-cypermethrin
Alpha-cypermethrin is a highly active pyrethroid insecticide; Used to control a wide range of chewing and sucking insects in fruits, vegetables, vines, cereals, maize, cotton, rice, other crops, and forestry; Also used as insecticide for public health pests and animal ectoparasiticide.
| Supplier | BOC Sciences |
|---|---|
| Product # | 67375-30-8 |
| Pricing | Inquire |
| Cas | 67375-30-8 |
| Molecular Weight | 416.3 |
| Molecular Formula | C22H19Cl2NO3 |
| Canonical SMILES | CC1(C(C1C(=O)OC(C#N)C2=CC(=CC=C2)OC3=CC=CC=C3)C=C(Cl)Cl)C |