3- (1, 3- Dioxolan- 2- yl) - 2- (2- propen- 1- yl) -phenol
3- (1, 3- Dioxolan- 2- yl) - 2- (2- propen- 1- yl) -phenol is a derivative of 2-Allyl-3-hydroxybenzaldehyde (A614503(P)), which is useful for diastereoselective preparation of bicyclic compounds.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB066384 |
| Pricing | Inquire |
| Cas | 773096-46-1 |
| Molecular Weight | 206.24 |
| Molecular Formula | C12H14O3 |
| Canonical SMILES | C=CCC1=C(C=CC=C1O)C2OCCO2 |