18-Methoxycoronaridine
18-Methoxycoronaridine is a derivative of ibogaine. It is a α3β4 nicotinic antagonist and, in contrast to ibogaine, has no affinity at the α4β2 subtype nor at NMDA-channels nor at the serotonin transporter, and has significantly reduced affinity for sodium channels and for the σ receptor, but retains modest affinity for μ-opioid receptors where it acts as an antagonist, and κ-opioid receptors.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2694-469383 |
| Pricing | Inquire |
| Cas | 308123-60-6 |
| Molecular Weight | 368.47 |
| Molecular Formula | C22H28N2O3 |
| Canonical SMILES | COCCC1CC2CC3(C1N(C2)CCC4=C3NC5=CC=CC=C45)C(=O)OC |