Dabigatran Impurity 8
N-[[2-[[[4-[[[(Hexyloxy)carbonyl]amino]carbonyl]phenyl]amino]methyl]-1-methyl-1H-benzimidazol-5-yl]carbonyl]-N-2-pyridinyl-β-alanine ethyl ester can be used as reference standards and markers. It can also be employed to analyze dabigatran eterxilate, dabigatran eterxilate mesylate, and its degraded products by various HPLC methods.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1408238-40-3 |
| Pricing | Inquire |
| Cas | 1408238-40-3 |
| Molecular Weight | 628.72 |
| Molecular Formula | C34H40N6O6 |
| Canonical SMILES | CCCCCCOC(=O)NC(=O)C1=CC=C(C=C1)NCC2=NC3=C(N2C)C=CC(=C3)C(=O)N(CCC(=O)OCC)C4=CC=CC=N4 |