5-Bromo-4-chloro-3-indolyl b-D-xylopyranoside
5-Bromo-4-chloro-3-indolyl b-D-xylopyranoside is a biochemical reagent widely used in the biomedical industry. It is primarily utilized as a substrate to detect β-D-xylosidase activity in various cells and tissues. This compound offers researchers insights into the enzymatic processes involved in certain diseases and can aid in drug development targeting such conditions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 207606-55-1 |
| Pricing | Inquire |
| Cas | 207606-55-1 |
| Molecular Weight | 378.6 |
| Molecular Formula | C13H13BrClNO5 |
| Canonical SMILES | C1C(C(C(C(O1)OC2=CNC3=C2C(=C(C=C3)Br)Cl)O)O)O |