Pantoprazole Impurity 1
An impurity of Pantoprazole which is a proton pump inhibitor used to treat erosive esophagitis (damage to the esophagus from stomach acid), and other conditions involving excess stomach acid such as Zollinger-Ellison syndrome.
| Supplier | BOC Sciences |
|---|---|
| Product # | 812664-93-0 |
| Pricing | Inquire |
| Cas | 812664-93-0 |
| Molecular Weight | 417.82 |
| Molecular Formula | C16H14ClF2N3O4S |
| Canonical SMILES | COC1=C(C(=NC=C1)C(S(=O)C2=NC3=C(N2)C=C(C=C3)OC(F)F)Cl)OC |