Bay 41-4109 less active enantiomer
Bay 41-4109 less active enantiomer exhibits less activity than Bay 41-4109 that is a novel class of drugs and inhibits hepatitis B virus (HBV) capsid formation and replication.
| Supplier | BOC Sciences |
|---|---|
| Product # | 476617-51-3 |
| Pricing | Inquire |
| Cas | 476617-51-3 |
| Molecular Weight | 395.76 |
| Molecular Formula | C18H13ClF3N3O2 |
| Canonical SMILES | CC1=C(C(N=C(N1)C2=C(C=C(C=N2)F)F)C3=C(C=C(C=C3)F)Cl)C(=O)OC |