APHA Compound 8
APHA Compound 8 is a synthetic HDAC (histone deacetylase) inhibitor, which is in the same structural class as SAHA. The IC50 for mouse HDAC1 is 0.5 µM. It induces histone hyperacetylation, growth inhibition, and terminal cell differentiation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 676599-90-9 |
| Pricing | Inquire |
| Cas | 676599-90-9 |
| Molecular Weight | 284.3 |
| Molecular Formula | C16H16N2O3 |
| Canonical SMILES | CN1C=C(C(CC2=CC=CC=C2)=O)C=C1/C=C/C(NO)=O |