5-Bromo-2-(2-methyl-2H-tetrazol-5-yl)-pyridine
5-Bromo-2-(2-methyl-2H-tetrazol-5-yl)-pyridine (CAS# 380380-64-3) is a reagent in the synthesis and structure-activity relationship studies of highly potent novel benzoxazinyl-oxazolidinone which is an antibacterial agent. Benzoxazinyl-oxazolidinone had potent activity against Gram-positive pathogens. 5-Bromo-2-(2-methyl-2H-tetrazol-5-yl)pyridine is also an intermediate in the synthesis of Tedizolid (T013750).
| Supplier | BOC Sciences |
|---|---|
| Product # | 380380-64-3 |
| Pricing | Inquire |
| Cas | 380380-64-3 |
| Molecular Weight | 240.06 |
| Molecular Formula | C7H6BrN5 |
| Canonical SMILES | CN1N=C(N=N1)C2=NC=C(C=C2)Br |