3'-O-Amino-2'-deoxyadenosine
3'-O-Amino-2'-deoxyadenosine is an indispensable compound extensively employed in the biomedical sector, serving as a pivotal constituent in the fabrication of antiviral remedies and nucleotide analogs. Renowned for its exclusive structural attributes, this compound assumes paramount significance in research of diverse viral ailments such as hepatitis B and HIV.
| Supplier | BOC Sciences |
|---|---|
| Product # | 132471-87-5 |
| Pricing | Inquire |
| Cas | 132471-87-5 |
| Molecular Weight | 266.26 |
| Molecular Formula | C10H14N6O3 |
| Canonical SMILES | C1C(C(OC1N2C=NC3=C(N=CN=C32)N)CO)ON |