Dykellic acid
It is produced by the strain of Westerdykella multispora F50733. It is an immunologically active substance. It can strongly inhibit LPS-induced B cell proliferation and the production of B cell polyclonal IgM antibody, as well as T cell proliferation. The expression of IL-2 and IL-4 genes in Th cells was inhibited.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-01188 |
| Pricing | Inquire |
| Cas | 1097679-78-1 |
| Molecular Weight | 248.27 |
| Molecular Formula | C14H16O4 |
| Canonical SMILES | CC=CC=CC1C(=C)C=C(C(=O)O1)CCC(=O)O |