5-Carboxymethylaminomethyluridine
5-Carboxymethylaminomethyluridine, an exquisitely remarkable biomedical product, finds its applicability in the management of specific viral infections and various neurological disorders. Leveraging its distinct characteristics, this compound has exhibited immense promise in thwarting viral replication and augmenting cognitive capabilities.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2706-339239 |
| Pricing | Inquire |
| Cas | 69181-26-6 |
| Molecular Weight | 331.28 |
| Molecular Formula | C12H17N3O8 |
| Canonical SMILES | C1=C(C(=O)NC(=O)N1C2C(C(C(O2)CO)O)O)CNCC(=O)O |